C12H14FN5O2 — CID 80920092
N-(3,4-dimethoxyphenyl)-5-fluoro-2-hydrazinylpyrimidin-4-amine (PubChem CID 80920092) has the molecular formula C12H14FN5O2 and a molecular weight of 279.28 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-5-fluoro-2-hydrazinylpyrimidin-4-amine.
| Compound Name | N-(3,4-dimethoxyphenyl)-5-fluoro-2-hydrazinylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80920092 |
| Molecular Formula | C12H14FN5O2 |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-5-fluoro-2-hydrazinylpyrimidin-4-amine |
| SMILES | COc1ccc(Nc2nc(NN)ncc2F)cc1OC |
| InChI | InChI=1S/C12H14FN5O2/c1-19-9-4-3-7(5-10(9)20-2)16-11-8(13)6-15-12(17-11)18-14/h3-6H,14H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | HIUDTCPXMJEUJO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|