C24H29FN5O2+ — CID 22060801
2-N-(1-benzylpiperidin-1-ium-1-yl)-4-N-(3,4-dimethoxyphenyl)-5-fluoropyrimidine-2,4-diamine (PubChem CID 22060801) has the molecular formula C24H29FN5O2+ and a molecular weight of 438.53 g/mol. Its IUPAC name is 2-N-(1-benzylpiperidin-1-ium-1-yl)-4-N-(3,4-dimethoxyphenyl)-5-fluoropyrimidine-2,4-diamine.
| Compound Name | 2-N-(1-benzylpiperidin-1-ium-1-yl)-4-N-(3,4-dimethoxyphenyl)-5-fluoropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 22060801 |
| Molecular Formula | C24H29FN5O2+ |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 2-N-(1-benzylpiperidin-1-ium-1-yl)-4-N-(3,4-dimethoxyphenyl)-5-fluoropyrimidine-2,4-diamine |
| SMILES | COc1ccc(Nc2nc(N[N+]3(Cc4ccccc4)CCCCC3)ncc2F)cc1OC |
| InChI | InChI=1S/C24H29FN5O2/c1-31-21-12-11-19(15-22(21)32-2)27-23-20(25)16-26-24(28-23)29-30(13-7-4-8-14-30)17-18-9-5-3-6-10-18/h3,5-6,9-12,15-16H,4,7-8,13-14,17H2,1-2H3,(H2,26,27,28,29)/q+1 |
| InChIKey | PVPFTBRAPPWUCB-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|