C14H14FN7 — CID 163280558
4-N-(3-aminophenyl)-5-fluoro-2-N-(1-methylpyrazol-4-yl)pyrimidine-2,4-diamine (PubChem CID 163280558) has the molecular formula C14H14FN7 and a molecular weight of 299.31 g/mol. Its IUPAC name is 4-N-(3-aminophenyl)-5-fluoro-2-N-(1-methylpyrazol-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(3-aminophenyl)-5-fluoro-2-N-(1-methylpyrazol-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 163280558 |
| Molecular Formula | C14H14FN7 |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 4-N-(3-aminophenyl)-5-fluoro-2-N-(1-methylpyrazol-4-yl)pyrimidine-2,4-diamine |
| SMILES | Cn1cc(Nc2ncc(F)c(Nc3cccc(N)c3)n2)cn1 |
| InChI | InChI=1S/C14H14FN7/c1-22-8-11(6-18-22)20-14-17-7-12(15)13(21-14)19-10-4-2-3-9(16)5-10/h2-8H,16H2,1H3,(H2,17,19,20,21) |
| InChIKey | JWQVNHJPIAYIDF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 93.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|