C20H22FN5O3 — CID 86724329
4-N-(3-aminophenyl)-5-fluoro-2-N-[4-(2-methoxyethoxymethoxy)phenyl]pyrimidine-2,4-diamine (PubChem CID 86724329) has the molecular formula C20H22FN5O3 and a molecular weight of 399.43 g/mol. Its IUPAC name is 4-N-(3-aminophenyl)-5-fluoro-2-N-[4-(2-methoxyethoxymethoxy)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(3-aminophenyl)-5-fluoro-2-N-[4-(2-methoxyethoxymethoxy)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 86724329 |
| Molecular Formula | C20H22FN5O3 |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 4-N-(3-aminophenyl)-5-fluoro-2-N-[4-(2-methoxyethoxymethoxy)phenyl]pyrimidine-2,4-diamine |
| SMILES | COCCOCOc1ccc(Nc2ncc(F)c(Nc3cccc(N)c3)n2)cc1 |
| InChI | InChI=1S/C20H22FN5O3/c1-27-9-10-28-13-29-17-7-5-15(6-8-17)25-20-23-12-18(21)19(26-20)24-16-4-2-3-14(22)11-16/h2-8,11-12H,9-10,13,22H2,1H3,(H2,23,24,25,26) |
| InChIKey | BSOZOROCXOMLKU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|