C26H21F6N5O4S — CID 169274895
2,3,4,5-tetrafluoro-N-[3-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]phenyl]-6-(fluoromethyl)benzenesulfonamide (PubChem CID 169274895) has the molecular formula C26H21F6N5O4S and a molecular weight of 613.54 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-N-[3-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]phenyl]-6-(fluoromethyl)benzenesulfonamide.
| Compound Name | 2,3,4,5-tetrafluoro-N-[3-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]phenyl]-6-(fluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 169274895 |
| Molecular Formula | C26H21F6N5O4S |
| Molecular Weight | 613.54 g/mol |
| Exact Mass | 613.12 |
| IUPAC Name | 2,3,4,5-tetrafluoro-N-[3-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]phenyl]-6-(fluoromethyl)benzenesulfonamide |
| SMILES | COCCOc1ccc(Nc2ncc(F)c(Nc3cccc(NS(=O)(=O)c4c(F)c(F)c(F)c(F)c4CF)c3)n2)cc1 |
| InChI | InChI=1S/C26H21F6N5O4S/c1-40-9-10-41-17-7-5-14(6-8-17)35-26-33-13-19(28)25(36-26)34-15-3-2-4-16(11-15)37-42(38,39)24-18(12-27)20(29)21(30)22(31)23(24)32/h2-8,11,13,37H,9-10,12H2,1H3,(H2,33,34,35,36) |
| InChIKey | RAXOBYLXAHBOHE-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.54 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|