C24H26FN5O2 — CID 118498484
5-fluoro-2-N-[4-(2-methoxyethoxy)phenyl]-4-N-spiro[1,2-dihydroindole-3,1'-cyclobutane]-6-ylpyrimidine-2,4-diamine (PubChem CID 118498484) has the molecular formula C24H26FN5O2 and a molecular weight of 435.50 g/mol. Its IUPAC name is 5-fluoro-2-N-[4-(2-methoxyethoxy)phenyl]-4-N-spiro[1,2-dihydroindole-3,1'-cyclobutane]-6-ylpyrimidine-2,4-diamine.
| Compound Name | 5-fluoro-2-N-[4-(2-methoxyethoxy)phenyl]-4-N-spiro[1,2-dihydroindole-3,1'-cyclobutane]-6-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 118498484 |
| Molecular Formula | C24H26FN5O2 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | 5-fluoro-2-N-[4-(2-methoxyethoxy)phenyl]-4-N-spiro[1,2-dihydroindole-3,1'-cyclobutane]-6-ylpyrimidine-2,4-diamine |
| SMILES | COCCOc1ccc(Nc2ncc(F)c(Nc3ccc4c(c3)NCC43CCC3)n2)cc1 |
| InChI | InChI=1S/C24H26FN5O2/c1-31-11-12-32-18-6-3-16(4-7-18)29-23-26-14-20(25)22(30-23)28-17-5-8-19-21(13-17)27-15-24(19)9-2-10-24/h3-8,13-14,27H,2,9-12,15H2,1H3,(H2,26,28,29,30) |
| InChIKey | RLRQASVWBAJTJS-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 80.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|