C23H27FN6O4 — CID 166068658
4-[3-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]anilino]-N-hydroxybutanamide (PubChem CID 166068658) has the molecular formula C23H27FN6O4 and a molecular weight of 470.51 g/mol. Its IUPAC name is 4-[3-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]anilino]-N-hydroxybutanamide.
| Compound Name | 4-[3-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]anilino]-N-hydroxybutanamide |
|---|---|
| PubChem CID | 166068658 |
| Molecular Formula | C23H27FN6O4 |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 4-[3-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]anilino]-N-hydroxybutanamide |
| SMILES | COCCOc1ccc(Nc2ncc(F)c(Nc3cccc(NCCCC(=O)NO)c3)n2)cc1 |
| InChI | InChI=1S/C23H27FN6O4/c1-33-12-13-34-19-9-7-16(8-10-19)28-23-26-15-20(24)22(29-23)27-18-5-2-4-17(14-18)25-11-3-6-21(31)30-32/h2,4-5,7-10,14-15,25,32H,3,6,11-13H2,1H3,(H,30,31)(H2,26,27,28,29) |
| InChIKey | WHQKGCZFGSZIBF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 129.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|