C26H29F3N6O4 — CID 164616173
N'-hydroxy-N-[4-[[4-(3-methoxyanilino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]octanediamide (PubChem CID 164616173) has the molecular formula C26H29F3N6O4 and a molecular weight of 546.55 g/mol. Its IUPAC name is N'-hydroxy-N-[4-[[4-(3-methoxyanilino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]octanediamide.
| Compound Name | N'-hydroxy-N-[4-[[4-(3-methoxyanilino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]octanediamide |
|---|---|
| PubChem CID | 164616173 |
| Molecular Formula | C26H29F3N6O4 |
| Molecular Weight | 546.55 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | N'-hydroxy-N-[4-[[4-(3-methoxyanilino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]octanediamide |
| SMILES | COc1cccc(Nc2nc(Nc3ccc(NC(=O)CCCCCCC(=O)NO)cc3)ncc2C(F)(F)F)c1 |
| InChI | InChI=1S/C26H29F3N6O4/c1-39-20-8-6-7-19(15-20)32-24-21(26(27,28)29)16-30-25(34-24)33-18-13-11-17(12-14-18)31-22(36)9-4-2-3-5-10-23(37)35-38/h6-8,11-16,38H,2-5,9-10H2,1H3,(H,31,36)(H,35,37)(H2,30,32,33,34) |
| InChIKey | LLCNZLLJWMLRSZ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 137.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.55 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|