C26H32N6O3 — CID 175168995
N-[7-(hydroxyamino)-7-oxoheptyl]-4-[[5-methyl-4-(3-methylanilino)pyrimidin-2-yl]amino]benzamide (PubChem CID 175168995) has the molecular formula C26H32N6O3 and a molecular weight of 476.58 g/mol. Its IUPAC name is N-[7-(hydroxyamino)-7-oxoheptyl]-4-[[5-methyl-4-(3-methylanilino)pyrimidin-2-yl]amino]benzamide.
| Compound Name | N-[7-(hydroxyamino)-7-oxoheptyl]-4-[[5-methyl-4-(3-methylanilino)pyrimidin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 175168995 |
| Molecular Formula | C26H32N6O3 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | N-[7-(hydroxyamino)-7-oxoheptyl]-4-[[5-methyl-4-(3-methylanilino)pyrimidin-2-yl]amino]benzamide |
| SMILES | Cc1cccc(Nc2nc(Nc3ccc(C(=O)NCCCCCCC(=O)NO)cc3)ncc2C)c1 |
| InChI | InChI=1S/C26H32N6O3/c1-18-8-7-9-22(16-18)29-24-19(2)17-28-26(31-24)30-21-13-11-20(12-14-21)25(34)27-15-6-4-3-5-10-23(33)32-35/h7-9,11-14,16-17,35H,3-6,10,15H2,1-2H3,(H,27,34)(H,32,33)(H2,28,29,30,31) |
| InChIKey | XLHKZLVHZUDEMJ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 128.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|