C24H26Cl2N6O3 — CID 164621159
N-[4-[[5-chloro-4-(2-chloroanilino)pyrimidin-2-yl]amino]phenyl]-N'-hydroxyoctanediamide (PubChem CID 164621159) has the molecular formula C24H26Cl2N6O3 and a molecular weight of 517.42 g/mol. Its IUPAC name is N-[4-[[5-chloro-4-(2-chloroanilino)pyrimidin-2-yl]amino]phenyl]-N'-hydroxyoctanediamide.
| Compound Name | N-[4-[[5-chloro-4-(2-chloroanilino)pyrimidin-2-yl]amino]phenyl]-N'-hydroxyoctanediamide |
|---|---|
| PubChem CID | 164621159 |
| Molecular Formula | C24H26Cl2N6O3 |
| Molecular Weight | 517.42 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | N-[4-[[5-chloro-4-(2-chloroanilino)pyrimidin-2-yl]amino]phenyl]-N'-hydroxyoctanediamide |
| SMILES | O=C(CCCCCCC(=O)Nc1ccc(Nc2ncc(Cl)c(Nc3ccccc3Cl)n2)cc1)NO |
| InChI | InChI=1S/C24H26Cl2N6O3/c25-18-7-5-6-8-20(18)30-23-19(26)15-27-24(31-23)29-17-13-11-16(12-14-17)28-21(33)9-3-1-2-4-10-22(34)32-35/h5-8,11-15,35H,1-4,9-10H2,(H,28,33)(H,32,34)(H2,27,29,30,31) |
| InChIKey | KCWFGDBDBQOADV-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 128.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.42 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|