C26H31ClFN7O5S — CID 168953991
4-[[5-chloro-4-[2-[methyl(methylsulfonyl)amino]anilino]pyrimidin-2-yl]amino]-2-fluoro-N-[7-(hydroxyamino)-7-oxoheptyl]benzamide (PubChem CID 168953991) has the molecular formula C26H31ClFN7O5S and a molecular weight of 608.10 g/mol. Its IUPAC name is 4-[[5-chloro-4-[2-[methyl(methylsulfonyl)amino]anilino]pyrimidin-2-yl]amino]-2-fluoro-N-[7-(hydroxyamino)-7-oxoheptyl]benzamide.
| Compound Name | 4-[[5-chloro-4-[2-[methyl(methylsulfonyl)amino]anilino]pyrimidin-2-yl]amino]-2-fluoro-N-[7-(hydroxyamino)-7-oxoheptyl]benzamide |
|---|---|
| PubChem CID | 168953991 |
| Molecular Formula | C26H31ClFN7O5S |
| Molecular Weight | 608.10 g/mol |
| Exact Mass | 607.18 |
| IUPAC Name | 4-[[5-chloro-4-[2-[methyl(methylsulfonyl)amino]anilino]pyrimidin-2-yl]amino]-2-fluoro-N-[7-(hydroxyamino)-7-oxoheptyl]benzamide |
| SMILES | CN(c1ccccc1Nc1nc(Nc2ccc(C(=O)NCCCCCCC(=O)NO)c(F)c2)ncc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C26H31ClFN7O5S/c1-35(41(2,39)40)22-10-7-6-9-21(22)32-24-19(27)16-30-26(33-24)31-17-12-13-18(20(28)15-17)25(37)29-14-8-4-3-5-11-23(36)34-38/h6-7,9-10,12-13,15-16,38H,3-5,8,11,14H2,1-2H3,(H,29,37)(H,34,36)(H2,30,31,32,33) |
| InChIKey | JUVBLFSHXRMISJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 165.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.10 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|