C18H13ClN4O4 — CID 70702131
2-[[2-(4-carboxyanilino)-5-chloropyrimidin-4-yl]amino]benzoic acid (PubChem CID 70702131) has the molecular formula C18H13ClN4O4 and a molecular weight of 384.78 g/mol. Its IUPAC name is 2-[[2-(4-carboxyanilino)-5-chloropyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 2-[[2-(4-carboxyanilino)-5-chloropyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 70702131 |
| Molecular Formula | C18H13ClN4O4 |
| Molecular Weight | 384.78 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | 2-[[2-(4-carboxyanilino)-5-chloropyrimidin-4-yl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(Nc2ncc(Cl)c(Nc3ccccc3C(=O)O)n2)cc1 |
| InChI | InChI=1S/C18H13ClN4O4/c19-13-9-20-18(21-11-7-5-10(6-8-11)16(24)25)23-15(13)22-14-4-2-1-3-12(14)17(26)27/h1-9H,(H,24,25)(H,26,27)(H2,20,21,22,23) |
| InChIKey | NJOOTPYHNUOYJJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.78 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |