C17H12ClIN4O2 — CID 166150113
4-[[5-chloro-4-(2-iodoanilino)pyrimidin-2-yl]amino]benzoic acid (PubChem CID 166150113) has the molecular formula C17H12ClIN4O2 and a molecular weight of 466.67 g/mol. Its IUPAC name is 4-[[5-chloro-4-(2-iodoanilino)pyrimidin-2-yl]amino]benzoic acid.
| Compound Name | 4-[[5-chloro-4-(2-iodoanilino)pyrimidin-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 166150113 |
| Molecular Formula | C17H12ClIN4O2 |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 465.97 |
| IUPAC Name | 4-[[5-chloro-4-(2-iodoanilino)pyrimidin-2-yl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(Nc2ncc(Cl)c(Nc3ccccc3I)n2)cc1 |
| InChI | InChI=1S/C17H12ClIN4O2/c18-12-9-20-17(21-11-7-5-10(6-8-11)16(24)25)23-15(12)22-14-4-2-1-3-13(14)19/h1-9H,(H,24,25)(H2,20,21,22,23) |
| InChIKey | FGWJEIDDHVSCKA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|