C22H13Cl3I2N6O3 — CID 157235877
4-[(4-chloro-5-iodopyrimidin-2-yl)amino]benzoic acid;4-[(4-chloro-5-iodopyrimidin-2-yl)amino]benzoyl chloride (PubChem CID 157235877) has the molecular formula C22H13Cl3I2N6O3 and a molecular weight of 769.55 g/mol. Its IUPAC name is 4-[(4-chloro-5-iodopyrimidin-2-yl)amino]benzoic acid;4-[(4-chloro-5-iodopyrimidin-2-yl)amino]benzoyl chloride.
| Compound Name | 4-[(4-chloro-5-iodopyrimidin-2-yl)amino]benzoic acid;4-[(4-chloro-5-iodopyrimidin-2-yl)amino]benzoyl chloride |
|---|---|
| PubChem CID | 157235877 |
| Molecular Formula | C22H13Cl3I2N6O3 |
| Molecular Weight | 769.55 g/mol |
| Exact Mass | 767.82 |
| IUPAC Name | 4-[(4-chloro-5-iodopyrimidin-2-yl)amino]benzoic acid;4-[(4-chloro-5-iodopyrimidin-2-yl)amino]benzoyl chloride |
| SMILES | O=C(Cl)c1ccc(Nc2ncc(I)c(Cl)n2)cc1.O=C(O)c1ccc(Nc2ncc(I)c(Cl)n2)cc1 |
| InChI | InChI=1S/C11H6Cl2IN3O.C11H7ClIN3O2/c12-9-8(14)5-15-11(17-9)16-7-3-1-6(2-4-7)10(13)18;12-9-8(13)5-14-11(16-9)15-7-3-1-6(2-4-7)10(17)18/h1-5H,(H,15,16,17);1-5H,(H,17,18)(H,14,15,16) |
| InChIKey | AUPYWRDKTUOVEB-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 129.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.55 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|