C13H8ClN3O2S — CID 82316540
4-[(4-chlorothieno[2,3-d]pyrimidin-2-yl)amino]benzoic acid (PubChem CID 82316540) has the molecular formula C13H8ClN3O2S and a molecular weight of 305.75 g/mol. Its IUPAC name is 4-[(4-chlorothieno[2,3-d]pyrimidin-2-yl)amino]benzoic acid.
| Compound Name | 4-[(4-chlorothieno[2,3-d]pyrimidin-2-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 82316540 |
| Molecular Formula | C13H8ClN3O2S |
| Molecular Weight | 305.75 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | 4-[(4-chlorothieno[2,3-d]pyrimidin-2-yl)amino]benzoic acid |
| SMILES | O=C(O)c1ccc(Nc2nc(Cl)c3ccsc3n2)cc1 |
| InChI | InChI=1S/C13H8ClN3O2S/c14-10-9-5-6-20-11(9)17-13(16-10)15-8-3-1-7(2-4-8)12(18)19/h1-6H,(H,18,19)(H,15,16,17) |
| InChIKey | ZDXNOMGWGGKLJL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.75 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |