About 5-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-2-hydroxybenzoic acid
5-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-2-hydroxybenzoic acid (PubChem CID 93214091) has the molecular formula C13H8ClN3O3S
and a molecular weight of 321.75 g/mol. Its IUPAC name is 5-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-2-hydroxybenzoic acid.
Molecular Properties
| Compound Name | 5-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-2-hydroxybenzoic acid |
| PubChem CID | 93214091 |
| Molecular Formula | C13H8ClN3O3S |
| Molecular Weight | 321.75 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | 5-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(Nc2nc(Cl)nc3sccc23)ccc1O |
| InChI | InChI=1S/C13H8ClN3O3S/c14-13-16-10(7-3-4-21-11(7)17-13)15-6-1-2-9(18)8(5-6)12(19)20/h1-5,18H,(H,19,20)(H,15,16,17) |
| InChIKey | PLWMXFBAVKXQMN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.75 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-2-hydroxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-2-hydroxybenzoic acid?
The IUPAC name of 5-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-2-hydroxybenzoic acid (CID 93214091) is 5-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-2-hydroxybenzoic acid.
What is the SMILES notation for 5-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-2-hydroxybenzoic acid?
The canonical SMILES for 5-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-2-hydroxybenzoic acid is O=C(O)c1cc(Nc2nc(Cl)nc3sccc23)ccc1O.
What is the InChIKey of 5-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-2-hydroxybenzoic acid?
The InChIKey is PLWMXFBAVKXQMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8ClN3O3S/c14-13-16-10(7-3-4-21-11(7)17-13)15-6-1-2-9(18)8(5-6)12(19)20/h1-5,18H,(H,19,20)(H,15,16,17).
What are the key properties of 5-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-2-hydroxybenzoic acid?
5-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-2-hydroxybenzoic acid has a molecular weight of 321.75 g/mol, XLogP of 3.49, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-2-hydroxybenzoic acid is sourced from PubChem (CID 93214091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).