C13H8ClN3O3S — CID 93214091
5-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-2-hydroxybenzoic acid (PubChem CID 93214091) has the molecular formula C13H8ClN3O3S and a molecular weight of 321.75 g/mol. Its IUPAC name is 5-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 93214091 |
| Molecular Formula | C13H8ClN3O3S |
| Molecular Weight | 321.75 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | 5-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(Nc2nc(Cl)nc3sccc23)ccc1O |
| InChI | InChI=1S/C13H8ClN3O3S/c14-13-16-10(7-3-4-21-11(7)17-13)15-6-1-2-9(18)8(5-6)12(19)20/h1-5,18H,(H,19,20)(H,15,16,17) |
| InChIKey | PLWMXFBAVKXQMN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.75 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|