C13H10ClN3OS — CID 82316516
4-chloro-N-(3-methoxyphenyl)thieno[2,3-d]pyrimidin-2-amine (PubChem CID 82316516) has the molecular formula C13H10ClN3OS and a molecular weight of 291.76 g/mol. Its IUPAC name is 4-chloro-N-(3-methoxyphenyl)thieno[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-chloro-N-(3-methoxyphenyl)thieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 82316516 |
| Molecular Formula | C13H10ClN3OS |
| Molecular Weight | 291.76 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | 4-chloro-N-(3-methoxyphenyl)thieno[2,3-d]pyrimidin-2-amine |
| SMILES | COc1cccc(Nc2nc(Cl)c3ccsc3n2)c1 |
| InChI | InChI=1S/C13H10ClN3OS/c1-18-9-4-2-3-8(7-9)15-13-16-11(14)10-5-6-19-12(10)17-13/h2-7H,1H3,(H,15,16,17) |
| InChIKey | AQVQZXHMVRWOLN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.76 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |