C13H9ClN2OS — CID 62178883
4-chloro-2-(3-methoxyphenyl)thieno[2,3-d]pyrimidine (PubChem CID 62178883) has the molecular formula C13H9ClN2OS and a molecular weight of 276.75 g/mol. Its IUPAC name is 4-chloro-2-(3-methoxyphenyl)thieno[2,3-d]pyrimidine.
| Compound Name | 4-chloro-2-(3-methoxyphenyl)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 62178883 |
| Molecular Formula | C13H9ClN2OS |
| Molecular Weight | 276.75 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 4-chloro-2-(3-methoxyphenyl)thieno[2,3-d]pyrimidine |
| SMILES | COc1cccc(-c2nc(Cl)c3ccsc3n2)c1 |
| InChI | InChI=1S/C13H9ClN2OS/c1-17-9-4-2-3-8(7-9)12-15-11(14)10-5-6-18-13(10)16-12/h2-7H,1H3 |
| InChIKey | OLYKQXKCWMFKPX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.75 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |