C14H10ClN3O2S — CID 93214104
methyl 3-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]benzoate (PubChem CID 93214104) has the molecular formula C14H10ClN3O2S and a molecular weight of 319.77 g/mol. Its IUPAC name is methyl 3-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]benzoate.
| Compound Name | methyl 3-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]benzoate |
|---|---|
| PubChem CID | 93214104 |
| Molecular Formula | C14H10ClN3O2S |
| Molecular Weight | 319.77 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | methyl 3-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]benzoate |
| SMILES | COC(=O)c1cccc(Nc2nc(Cl)nc3sccc23)c1 |
| InChI | InChI=1S/C14H10ClN3O2S/c1-20-13(19)8-3-2-4-9(7-8)16-11-10-5-6-21-12(10)18-14(15)17-11/h2-7H,1H3,(H,16,17,18) |
| InChIKey | RLCQWMNVCVANDB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.77 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |