About [2-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]phenyl]carbamic acid
[2-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]phenyl]carbamic acid (PubChem CID 155415470) has the molecular formula C13H9ClN4O2S
and a molecular weight of 320.76 g/mol. Its IUPAC name is [2-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]phenyl]carbamic acid.
Molecular Properties
| Compound Name | [2-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]phenyl]carbamic acid |
| PubChem CID | 155415470 |
| Molecular Formula | C13H9ClN4O2S |
| Molecular Weight | 320.76 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | [2-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]phenyl]carbamic acid |
| SMILES | O=C(O)Nc1ccccc1Nc1nc(Cl)nc2sccc12 |
| InChI | InChI=1S/C13H9ClN4O2S/c14-12-17-10(7-5-6-21-11(7)18-12)15-8-3-1-2-4-9(8)16-13(19)20/h1-6,16H,(H,19,20)(H,15,17,18) |
| InChIKey | XOVFGCBPGIRAMW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.76 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]phenyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]phenyl]carbamic acid?
The IUPAC name of [2-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]phenyl]carbamic acid (CID 155415470) is [2-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]phenyl]carbamic acid.
What is the SMILES notation for [2-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]phenyl]carbamic acid?
The canonical SMILES for [2-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]phenyl]carbamic acid is O=C(O)Nc1ccccc1Nc1nc(Cl)nc2sccc12.
What is the InChIKey of [2-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]phenyl]carbamic acid?
The InChIKey is XOVFGCBPGIRAMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9ClN4O2S/c14-12-17-10(7-5-6-21-11(7)18-12)15-8-3-1-2-4-9(8)16-13(19)20/h1-6,16H,(H,19,20)(H,15,17,18).
What are the key properties of [2-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]phenyl]carbamic acid?
[2-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]phenyl]carbamic acid has a molecular weight of 320.76 g/mol, XLogP of 4.18, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]phenyl]carbamic acid is sourced from PubChem (CID 155415470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).