C12H6Br2ClN3S — CID 103320957
2-chloro-N-(2,5-dibromophenyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 103320957) has the molecular formula C12H6Br2ClN3S and a molecular weight of 419.53 g/mol. Its IUPAC name is 2-chloro-N-(2,5-dibromophenyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-chloro-N-(2,5-dibromophenyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103320957 |
| Molecular Formula | C12H6Br2ClN3S |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 416.83 |
| IUPAC Name | 2-chloro-N-(2,5-dibromophenyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Clc1nc(Nc2cc(Br)ccc2Br)c2ccsc2n1 |
| InChI | InChI=1S/C12H6Br2ClN3S/c13-6-1-2-8(14)9(5-6)16-10-7-3-4-19-11(7)18-12(15)17-10/h1-5H,(H,16,17,18) |
| InChIKey | YZNRRUQEQZNKQB-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |