C12H6ClF2N3S — CID 103320380
2-chloro-N-(3,4-difluorophenyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 103320380) has the molecular formula C12H6ClF2N3S and a molecular weight of 297.72 g/mol. Its IUPAC name is 2-chloro-N-(3,4-difluorophenyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-chloro-N-(3,4-difluorophenyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103320380 |
| Molecular Formula | C12H6ClF2N3S |
| Molecular Weight | 297.72 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | 2-chloro-N-(3,4-difluorophenyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Fc1ccc(Nc2nc(Cl)nc3sccc23)cc1F |
| InChI | InChI=1S/C12H6ClF2N3S/c13-12-17-10(7-3-4-19-11(7)18-12)16-6-1-2-8(14)9(15)5-6/h1-5H,(H,16,17,18) |
| InChIKey | ZKFZBSKUBLEQFG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.72 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |