About methyl 4-anilinothieno[3,2-c]pyridine-6-carboxylate
methyl 4-anilinothieno[3,2-c]pyridine-6-carboxylate (PubChem CID 53321904) has the molecular formula C15H12N2O2S
and a molecular weight of 284.34 g/mol. Its IUPAC name is methyl 4-anilinothieno[3,2-c]pyridine-6-carboxylate.
Molecular Properties
| Compound Name | methyl 4-anilinothieno[3,2-c]pyridine-6-carboxylate |
| PubChem CID | 53321904 |
| Molecular Formula | C15H12N2O2S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | methyl 4-anilinothieno[3,2-c]pyridine-6-carboxylate |
| SMILES | COC(=O)c1cc2sccc2c(Nc2ccccc2)n1 |
| InChI | InChI=1S/C15H12N2O2S/c1-19-15(18)12-9-13-11(7-8-20-13)14(17-12)16-10-5-3-2-4-6-10/h2-9H,1H3,(H,16,17) |
| InChIKey | IYTAFKFJVMFFJQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-anilinothieno[3,2-c]pyridine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-anilinothieno[3,2-c]pyridine-6-carboxylate?
The IUPAC name of methyl 4-anilinothieno[3,2-c]pyridine-6-carboxylate (CID 53321904) is methyl 4-anilinothieno[3,2-c]pyridine-6-carboxylate.
What is the SMILES notation for methyl 4-anilinothieno[3,2-c]pyridine-6-carboxylate?
The canonical SMILES for methyl 4-anilinothieno[3,2-c]pyridine-6-carboxylate is COC(=O)c1cc2sccc2c(Nc2ccccc2)n1.
What is the InChIKey of methyl 4-anilinothieno[3,2-c]pyridine-6-carboxylate?
The InChIKey is IYTAFKFJVMFFJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O2S/c1-19-15(18)12-9-13-11(7-8-20-13)14(17-12)16-10-5-3-2-4-6-10/h2-9H,1H3,(H,16,17).
What are the key properties of methyl 4-anilinothieno[3,2-c]pyridine-6-carboxylate?
methyl 4-anilinothieno[3,2-c]pyridine-6-carboxylate has a molecular weight of 284.34 g/mol, XLogP of 3.83, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-anilinothieno[3,2-c]pyridine-6-carboxylate is sourced from PubChem (CID 53321904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).