C15H10FNO2S — CID 102538286
methyl 4-(4-fluorophenyl)thieno[3,2-c]pyridine-6-carboxylate (PubChem CID 102538286) has the molecular formula C15H10FNO2S and a molecular weight of 287.32 g/mol. Its IUPAC name is methyl 4-(4-fluorophenyl)thieno[3,2-c]pyridine-6-carboxylate.
| Compound Name | methyl 4-(4-fluorophenyl)thieno[3,2-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 102538286 |
| Molecular Formula | C15H10FNO2S |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | methyl 4-(4-fluorophenyl)thieno[3,2-c]pyridine-6-carboxylate |
| SMILES | COC(=O)c1cc2sccc2c(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C15H10FNO2S/c1-19-15(18)12-8-13-11(6-7-20-13)14(17-12)9-2-4-10(16)5-3-9/h2-8H,1H3 |
| InChIKey | MDWIHDNPZGTPPP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |