C15H10ClFN2O2S — CID 90451064
methyl 4-amino-6-(1-benzothiophen-4-yl)-3-chloro-5-fluoropyridine-2-carboxylate (PubChem CID 90451064) has the molecular formula C15H10ClFN2O2S and a molecular weight of 336.78 g/mol. Its IUPAC name is methyl 4-amino-6-(1-benzothiophen-4-yl)-3-chloro-5-fluoropyridine-2-carboxylate.
| Compound Name | methyl 4-amino-6-(1-benzothiophen-4-yl)-3-chloro-5-fluoropyridine-2-carboxylate |
|---|---|
| PubChem CID | 90451064 |
| Molecular Formula | C15H10ClFN2O2S |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | methyl 4-amino-6-(1-benzothiophen-4-yl)-3-chloro-5-fluoropyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(-c2cccc3sccc23)c(F)c(N)c1Cl |
| InChI | InChI=1S/C15H10ClFN2O2S/c1-21-15(20)14-10(16)12(18)11(17)13(19-14)8-3-2-4-9-7(8)5-6-22-9/h2-6H,1H3,(H2,18,19) |
| InChIKey | KNVIIZNVHXREJB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |