C23H18ClF2IN2O5 — CID 118258665
(2-methoxycarbonylphenyl)methyl 4-amino-3-chloro-5-fluoro-6-[2-fluoro-4-(iodomethyl)-3-methoxyphenyl]pyridine-2-carboxylate (PubChem CID 118258665) has the molecular formula C23H18ClF2IN2O5 and a molecular weight of 602.76 g/mol. Its IUPAC name is (2-methoxycarbonylphenyl)methyl 4-amino-3-chloro-5-fluoro-6-[2-fluoro-4-(iodomethyl)-3-methoxyphenyl]pyridine-2-carboxylate.
| Compound Name | (2-methoxycarbonylphenyl)methyl 4-amino-3-chloro-5-fluoro-6-[2-fluoro-4-(iodomethyl)-3-methoxyphenyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 118258665 |
| Molecular Formula | C23H18ClF2IN2O5 |
| Molecular Weight | 602.76 g/mol |
| Exact Mass | 601.99 |
| IUPAC Name | (2-methoxycarbonylphenyl)methyl 4-amino-3-chloro-5-fluoro-6-[2-fluoro-4-(iodomethyl)-3-methoxyphenyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccccc1COC(=O)c1nc(-c2ccc(CI)c(OC)c2F)c(F)c(N)c1Cl |
| InChI | InChI=1S/C23H18ClF2IN2O5/c1-32-21-11(9-27)7-8-14(16(21)25)19-17(26)18(28)15(24)20(29-19)23(31)34-10-12-5-3-4-6-13(12)22(30)33-2/h3-8H,9-10H2,1-2H3,(H2,28,29) |
| InChIKey | OFHTVKZWQPXYNE-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 100.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.76 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|