C14H8ClF3N2O3 — CID 90408725
methyl 4-amino-3-chloro-6-(2,3-difluoro-4-formylphenyl)-5-fluoropyridine-2-carboxylate (PubChem CID 90408725) has the molecular formula C14H8ClF3N2O3 and a molecular weight of 344.68 g/mol. Its IUPAC name is methyl 4-amino-3-chloro-6-(2,3-difluoro-4-formylphenyl)-5-fluoropyridine-2-carboxylate.
| Compound Name | methyl 4-amino-3-chloro-6-(2,3-difluoro-4-formylphenyl)-5-fluoropyridine-2-carboxylate |
|---|---|
| PubChem CID | 90408725 |
| Molecular Formula | C14H8ClF3N2O3 |
| Molecular Weight | 344.68 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | methyl 4-amino-3-chloro-6-(2,3-difluoro-4-formylphenyl)-5-fluoropyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccc(C=O)c(F)c2F)c(F)c(N)c1Cl |
| InChI | InChI=1S/C14H8ClF3N2O3/c1-23-14(22)13-7(15)11(19)10(18)12(20-13)6-3-2-5(4-21)8(16)9(6)17/h2-4H,1H3,(H2,19,20) |
| InChIKey | KEAKTSIHENLLPO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.68 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|