C16H13F2N3O2 — CID 126609387
methyl 4-amino-5-fluoro-6-(7-fluoro-1H-indol-6-yl)-3-methylpyridine-2-carboxylate (PubChem CID 126609387) has the molecular formula C16H13F2N3O2 and a molecular weight of 317.30 g/mol. Its IUPAC name is methyl 4-amino-5-fluoro-6-(7-fluoro-1H-indol-6-yl)-3-methylpyridine-2-carboxylate.
| Compound Name | methyl 4-amino-5-fluoro-6-(7-fluoro-1H-indol-6-yl)-3-methylpyridine-2-carboxylate |
|---|---|
| PubChem CID | 126609387 |
| Molecular Formula | C16H13F2N3O2 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | methyl 4-amino-5-fluoro-6-(7-fluoro-1H-indol-6-yl)-3-methylpyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccc3cc[nH]c3c2F)c(F)c(N)c1C |
| InChI | InChI=1S/C16H13F2N3O2/c1-7-12(19)11(18)15(21-13(7)16(22)23-2)9-4-3-8-5-6-20-14(8)10(9)17/h3-6,20H,1-2H3,(H2,19,21) |
| InChIKey | VUKPIAXIPKBWNO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |