C16H14ClF2N3O2 — CID 153350025
4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylic acid;ethane (PubChem CID 153350025) has the molecular formula C16H14ClF2N3O2 and a molecular weight of 353.76 g/mol. Its IUPAC name is 4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylic acid;ethane.
| Compound Name | 4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylic acid;ethane |
|---|---|
| PubChem CID | 153350025 |
| Molecular Formula | C16H14ClF2N3O2 |
| Molecular Weight | 353.76 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylic acid;ethane |
| SMILES | CC.Nc1c(F)c(-c2ccc3cc[nH]c3c2F)nc(C(=O)O)c1Cl |
| InChI | InChI=1S/C14H8ClF2N3O2.C2H6/c15-7-10(18)9(17)12(20-13(7)14(21)22)6-2-1-5-3-4-19-11(5)8(6)16;1-2/h1-4,19H,(H2,18,20)(H,21,22);1-2H3 |
| InChIKey | NJFBWGKYSVPLES-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.76 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |