About sodium;4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylic acid;hydride
sodium;4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylic acid;hydride (PubChem CID 175389232) has the molecular formula C14H9ClF2N3NaO2
and a molecular weight of 347.68 g/mol. Its IUPAC name is sodium;4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylic acid;hydride.
Molecular Properties
| Compound Name | sodium;4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylic acid;hydride |
| PubChem CID | 175389232 |
| Molecular Formula | C14H9ClF2N3NaO2 |
| Molecular Weight | 347.68 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | sodium;4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylic acid;hydride |
| SMILES | Nc1c(F)c(-c2ccc3cc[nH]c3c2F)nc(C(=O)O)c1Cl.[H-].[Na+] |
| InChI | InChI=1S/C14H8ClF2N3O2.Na.H/c15-7-10(18)9(17)12(20-13(7)14(21)22)6-2-1-5-3-4-19-11(5)8(6)16;;/h1-4,19H,(H2,18,20)(H,21,22);;/q;+1;-1 |
| InChIKey | AOASNSFVJHYNMO-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.68 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium;4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylic acid;hydride?
The IUPAC name of sodium;4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylic acid;hydride (CID 175389232) is sodium;4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylic acid;hydride.
What is the SMILES notation for sodium;4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylic acid;hydride?
The canonical SMILES for sodium;4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylic acid;hydride is Nc1c(F)c(-c2ccc3cc[nH]c3c2F)nc(C(=O)O)c1Cl.[H-].[Na+].
What is the InChIKey of sodium;4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylic acid;hydride?
The InChIKey is AOASNSFVJHYNMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8ClF2N3O2.Na.H/c15-7-10(18)9(17)12(20-13(7)14(21)22)6-2-1-5-3-4-19-11(5)8(6)16;;/h1-4,19H,(H2,18,20)(H,21,22);;/q;+1;-1.
What are the key properties of sodium;4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylic acid;hydride?
sodium;4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylic acid;hydride has a molecular weight of 347.68 g/mol, XLogP of 0.56, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;4-amino-3-chloro-5-fluoro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylic acid;hydride is sourced from PubChem (CID 175389232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).