C12H6Cl2F2N2O4 — CID 154956016
4-amino-3-chloro-6-(4-chloro-2-fluoro-3-hydroperoxyphenyl)-5-fluoropyridine-2-carboxylic acid (PubChem CID 154956016) has the molecular formula C12H6Cl2F2N2O4 and a molecular weight of 351.09 g/mol. Its IUPAC name is 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-hydroperoxyphenyl)-5-fluoropyridine-2-carboxylic acid.
| Compound Name | 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-hydroperoxyphenyl)-5-fluoropyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 154956016 |
| Molecular Formula | C12H6Cl2F2N2O4 |
| Molecular Weight | 351.09 g/mol |
| Exact Mass | 349.97 |
| IUPAC Name | 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-hydroperoxyphenyl)-5-fluoropyridine-2-carboxylic acid |
| SMILES | Nc1c(F)c(-c2ccc(Cl)c(OO)c2F)nc(C(=O)O)c1Cl |
| InChI | InChI=1S/C12H6Cl2F2N2O4/c13-4-2-1-3(6(15)11(4)22-21)9-7(16)8(17)5(14)10(18-9)12(19)20/h1-2,21H,(H2,17,18)(H,19,20) |
| InChIKey | NAFORBCMHVNHKN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.09 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|