C13H10Cl2FN2O3P — CID 155064884
4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-phosphanylpyridine-2-carboxylic acid (PubChem CID 155064884) has the molecular formula C13H10Cl2FN2O3P and a molecular weight of 363.11 g/mol. Its IUPAC name is 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-phosphanylpyridine-2-carboxylic acid.
| Compound Name | 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-phosphanylpyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 155064884 |
| Molecular Formula | C13H10Cl2FN2O3P |
| Molecular Weight | 363.11 g/mol |
| Exact Mass | 361.98 |
| IUPAC Name | 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-phosphanylpyridine-2-carboxylic acid |
| SMILES | COc1c(Cl)ccc(-c2nc(C(=O)O)c(Cl)c(N)c2P)c1F |
| InChI | InChI=1S/C13H10Cl2FN2O3P/c1-21-11-5(14)3-2-4(7(11)16)9-12(22)8(17)6(15)10(18-9)13(19)20/h2-3H,22H2,1H3,(H2,17,18)(H,19,20) |
| InChIKey | TZSOSZJOHAWWSB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.11 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|