C13H9ClF2N2O3 — CID 71175273
4-amino-6-(4-chloro-3-fluorophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid (PubChem CID 71175273) has the molecular formula C13H9ClF2N2O3 and a molecular weight of 314.68 g/mol. Its IUPAC name is 4-amino-6-(4-chloro-3-fluorophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid.
| Compound Name | 4-amino-6-(4-chloro-3-fluorophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 71175273 |
| Molecular Formula | C13H9ClF2N2O3 |
| Molecular Weight | 314.68 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 4-amino-6-(4-chloro-3-fluorophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid |
| SMILES | COc1c(C(=O)O)nc(-c2ccc(Cl)c(F)c2)c(F)c1N |
| InChI | InChI=1S/C13H9ClF2N2O3/c1-21-12-9(17)8(16)10(18-11(12)13(19)20)5-2-3-6(14)7(15)4-5/h2-4H,1H3,(H2,17,18)(H,19,20) |
| InChIKey | OERVUNSBFXJPHW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.68 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |