C13H8F3IN2O3 — CID 71175280
4-amino-6-(2,5-difluoro-4-iodophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid (PubChem CID 71175280) has the molecular formula C13H8F3IN2O3 and a molecular weight of 424.12 g/mol. Its IUPAC name is 4-amino-6-(2,5-difluoro-4-iodophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid.
| Compound Name | 4-amino-6-(2,5-difluoro-4-iodophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 71175280 |
| Molecular Formula | C13H8F3IN2O3 |
| Molecular Weight | 424.12 g/mol |
| Exact Mass | 423.95 |
| IUPAC Name | 4-amino-6-(2,5-difluoro-4-iodophenyl)-5-fluoro-3-methoxypyridine-2-carboxylic acid |
| SMILES | COc1c(C(=O)O)nc(-c2cc(F)c(I)cc2F)c(F)c1N |
| InChI | InChI=1S/C13H8F3IN2O3/c1-22-12-9(18)8(16)10(19-11(12)13(20)21)4-2-6(15)7(17)3-5(4)14/h2-3H,1H3,(H2,18,19)(H,20,21) |
| InChIKey | SRCGFPRPVZGHFQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.12 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|