C12H9F3N4O2 — CID 88852558
3,5-diamino-6-(3,4,5-trifluoro-2-methylphenyl)pyrazine-2-carboxylic acid (PubChem CID 88852558) has the molecular formula C12H9F3N4O2 and a molecular weight of 298.22 g/mol. Its IUPAC name is 3,5-diamino-6-(3,4,5-trifluoro-2-methylphenyl)pyrazine-2-carboxylic acid.
| Compound Name | 3,5-diamino-6-(3,4,5-trifluoro-2-methylphenyl)pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 88852558 |
| Molecular Formula | C12H9F3N4O2 |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 3,5-diamino-6-(3,4,5-trifluoro-2-methylphenyl)pyrazine-2-carboxylic acid |
| SMILES | Cc1c(-c2nc(C(=O)O)c(N)nc2N)cc(F)c(F)c1F |
| InChI | InChI=1S/C12H9F3N4O2/c1-3-4(2-5(13)7(15)6(3)14)8-10(16)19-11(17)9(18-8)12(20)21/h2H,1H3,(H,20,21)(H4,16,17,19) |
| InChIKey | AWRLUCOFMBAVNR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 115.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|