C16H16F2N2O3 — CID 137384098
4-amino-3-ethyl-5-fluoro-6-(2-fluoro-3-methoxy-4-methylphenyl)pyridine-2-carboxylic acid (PubChem CID 137384098) has the molecular formula C16H16F2N2O3 and a molecular weight of 322.31 g/mol. Its IUPAC name is 4-amino-3-ethyl-5-fluoro-6-(2-fluoro-3-methoxy-4-methylphenyl)pyridine-2-carboxylic acid.
| Compound Name | 4-amino-3-ethyl-5-fluoro-6-(2-fluoro-3-methoxy-4-methylphenyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 137384098 |
| Molecular Formula | C16H16F2N2O3 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 4-amino-3-ethyl-5-fluoro-6-(2-fluoro-3-methoxy-4-methylphenyl)pyridine-2-carboxylic acid |
| SMILES | CCc1c(C(=O)O)nc(-c2ccc(C)c(OC)c2F)c(F)c1N |
| InChI | InChI=1S/C16H16F2N2O3/c1-4-8-12(19)11(18)13(20-14(8)16(21)22)9-6-5-7(2)15(23-3)10(9)17/h5-6H,4H2,1-3H3,(H2,19,20)(H,21,22) |
| InChIKey | MUTRFIIUDQVBLJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |