C16H17FN2O4 — CID 147624077
methyl 4-amino-6-(2-fluoro-3-methoxy-4-methylphenyl)-3-methoxypyridine-2-carboxylate (PubChem CID 147624077) has the molecular formula C16H17FN2O4 and a molecular weight of 320.32 g/mol. Its IUPAC name is methyl 4-amino-6-(2-fluoro-3-methoxy-4-methylphenyl)-3-methoxypyridine-2-carboxylate.
| Compound Name | methyl 4-amino-6-(2-fluoro-3-methoxy-4-methylphenyl)-3-methoxypyridine-2-carboxylate |
|---|---|
| PubChem CID | 147624077 |
| Molecular Formula | C16H17FN2O4 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | methyl 4-amino-6-(2-fluoro-3-methoxy-4-methylphenyl)-3-methoxypyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccc(C)c(OC)c2F)cc(N)c1OC |
| InChI | InChI=1S/C16H17FN2O4/c1-8-5-6-9(12(17)14(8)21-2)11-7-10(18)15(22-3)13(19-11)16(20)23-4/h5-7H,1-4H3,(H2,18,19) |
| InChIKey | GEKWIBIQPAVRJS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |