C15H13Cl2FN2O2 — CID 90441333
methyl 4-amino-3-chloro-6-(4-chloro-2-ethyl-3-fluorophenyl)pyridine-2-carboxylate (PubChem CID 90441333) has the molecular formula C15H13Cl2FN2O2 and a molecular weight of 343.19 g/mol. Its IUPAC name is methyl 4-amino-3-chloro-6-(4-chloro-2-ethyl-3-fluorophenyl)pyridine-2-carboxylate.
| Compound Name | methyl 4-amino-3-chloro-6-(4-chloro-2-ethyl-3-fluorophenyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 90441333 |
| Molecular Formula | C15H13Cl2FN2O2 |
| Molecular Weight | 343.19 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | methyl 4-amino-3-chloro-6-(4-chloro-2-ethyl-3-fluorophenyl)pyridine-2-carboxylate |
| SMILES | CCc1c(-c2cc(N)c(Cl)c(C(=O)OC)n2)ccc(Cl)c1F |
| InChI | InChI=1S/C15H13Cl2FN2O2/c1-3-7-8(4-5-9(16)13(7)18)11-6-10(19)12(17)14(20-11)15(21)22-2/h4-6H,3H2,1-2H3,(H2,19,20) |
| InChIKey | VRWLOTXNBUBFAA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.19 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |