C13H9ClFIN2O2 — CID 90440355
methyl 4-amino-3-chloro-6-(2-fluoro-4-iodophenyl)pyridine-2-carboxylate (PubChem CID 90440355) has the molecular formula C13H9ClFIN2O2 and a molecular weight of 406.58 g/mol. Its IUPAC name is methyl 4-amino-3-chloro-6-(2-fluoro-4-iodophenyl)pyridine-2-carboxylate.
| Compound Name | methyl 4-amino-3-chloro-6-(2-fluoro-4-iodophenyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 90440355 |
| Molecular Formula | C13H9ClFIN2O2 |
| Molecular Weight | 406.58 g/mol |
| Exact Mass | 405.94 |
| IUPAC Name | methyl 4-amino-3-chloro-6-(2-fluoro-4-iodophenyl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccc(I)cc2F)cc(N)c1Cl |
| InChI | InChI=1S/C13H9ClFIN2O2/c1-20-13(19)12-11(14)9(17)5-10(18-12)7-3-2-6(16)4-8(7)15/h2-5H,1H3,(H2,17,18) |
| InChIKey | LWWBSCALIOOUKJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.58 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|