C14H9Cl2FN2O3 — CID 129168945
methyl 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-formylphenyl)pyridine-2-carboxylate (PubChem CID 129168945) has the molecular formula C14H9Cl2FN2O3 and a molecular weight of 343.14 g/mol. Its IUPAC name is methyl 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-formylphenyl)pyridine-2-carboxylate.
| Compound Name | methyl 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-formylphenyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 129168945 |
| Molecular Formula | C14H9Cl2FN2O3 |
| Molecular Weight | 343.14 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | methyl 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-formylphenyl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccc(Cl)c(C=O)c2F)cc(N)c1Cl |
| InChI | InChI=1S/C14H9Cl2FN2O3/c1-22-14(21)13-11(16)9(18)4-10(19-13)6-2-3-8(15)7(5-20)12(6)17/h2-5H,1H3,(H2,18,19) |
| InChIKey | NSNWYICALKZRGD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.14 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|