C15H12Cl2FNO3 — CID 138549772
methyl 3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-4-methylpyridine-2-carboxylate (PubChem CID 138549772) has the molecular formula C15H12Cl2FNO3 and a molecular weight of 344.17 g/mol. Its IUPAC name is methyl 3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-4-methylpyridine-2-carboxylate.
| Compound Name | methyl 3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-4-methylpyridine-2-carboxylate |
|---|---|
| PubChem CID | 138549772 |
| Molecular Formula | C15H12Cl2FNO3 |
| Molecular Weight | 344.17 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | methyl 3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-4-methylpyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccc(Cl)c(OC)c2F)cc(C)c1Cl |
| InChI | InChI=1S/C15H12Cl2FNO3/c1-7-6-10(19-13(11(7)17)15(20)22-3)8-4-5-9(16)14(21-2)12(8)18/h4-6H,1-3H3 |
| InChIKey | XIJALXAYUFREBL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.17 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |