C14H11Cl3N2O2 — CID 22677283
ethyl 4-amino-3-chloro-6-(2,4-dichlorophenyl)pyridine-2-carboxylate (PubChem CID 22677283) has the molecular formula C14H11Cl3N2O2 and a molecular weight of 345.61 g/mol. Its IUPAC name is ethyl 4-amino-3-chloro-6-(2,4-dichlorophenyl)pyridine-2-carboxylate.
| Compound Name | ethyl 4-amino-3-chloro-6-(2,4-dichlorophenyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 22677283 |
| Molecular Formula | C14H11Cl3N2O2 |
| Molecular Weight | 345.61 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | ethyl 4-amino-3-chloro-6-(2,4-dichlorophenyl)pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2ccc(Cl)cc2Cl)cc(N)c1Cl |
| InChI | InChI=1S/C14H11Cl3N2O2/c1-2-21-14(20)13-12(17)10(18)6-11(19-13)8-4-3-7(15)5-9(8)16/h3-6H,2H2,1H3,(H2,18,19) |
| InChIKey | WKNBBLJWALGDQZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.61 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |