C14H14FN3O3 — CID 90440255
methyl 6-amino-2-(2-fluoro-4-methylphenyl)-5-methoxypyrimidine-4-carboxylate (PubChem CID 90440255) has the molecular formula C14H14FN3O3 and a molecular weight of 291.28 g/mol. Its IUPAC name is methyl 6-amino-2-(2-fluoro-4-methylphenyl)-5-methoxypyrimidine-4-carboxylate.
| Compound Name | methyl 6-amino-2-(2-fluoro-4-methylphenyl)-5-methoxypyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 90440255 |
| Molecular Formula | C14H14FN3O3 |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | methyl 6-amino-2-(2-fluoro-4-methylphenyl)-5-methoxypyrimidine-4-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccc(C)cc2F)nc(N)c1OC |
| InChI | InChI=1S/C14H14FN3O3/c1-7-4-5-8(9(15)6-7)13-17-10(14(19)21-3)11(20-2)12(16)18-13/h4-6H,1-3H3,(H2,16,17,18) |
| InChIKey | BPKNMCRTFQEUOK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |