C17H19ClFN3O2Si — CID 70497064
methyl 6-amino-2-(4-chloro-2-fluorophenyl)-5-(2-trimethylsilylethenyl)pyrimidine-4-carboxylate (PubChem CID 70497064) has the molecular formula C17H19ClFN3O2Si and a molecular weight of 379.90 g/mol. Its IUPAC name is methyl 6-amino-2-(4-chloro-2-fluorophenyl)-5-(2-trimethylsilylethenyl)pyrimidine-4-carboxylate.
| Compound Name | methyl 6-amino-2-(4-chloro-2-fluorophenyl)-5-(2-trimethylsilylethenyl)pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 70497064 |
| Molecular Formula | C17H19ClFN3O2Si |
| Molecular Weight | 379.90 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | methyl 6-amino-2-(4-chloro-2-fluorophenyl)-5-(2-trimethylsilylethenyl)pyrimidine-4-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccc(Cl)cc2F)nc(N)c1C=C[Si](C)(C)C |
| InChI | InChI=1S/C17H19ClFN3O2Si/c1-24-17(23)14-12(7-8-25(2,3)4)15(20)22-16(21-14)11-6-5-10(18)9-13(11)19/h5-9H,1-4H3,(H2,20,21,22) |
| InChIKey | LZAKVPSKSREWLC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.90 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|