C18H20ClFN2O2Si — CID 70498124
methyl 4-amino-6-(4-chlorophenyl)-5-fluoro-3-(2-trimethylsilylethenyl)pyridine-2-carboxylate (PubChem CID 70498124) has the molecular formula C18H20ClFN2O2Si and a molecular weight of 378.91 g/mol. Its IUPAC name is methyl 4-amino-6-(4-chlorophenyl)-5-fluoro-3-(2-trimethylsilylethenyl)pyridine-2-carboxylate.
| Compound Name | methyl 4-amino-6-(4-chlorophenyl)-5-fluoro-3-(2-trimethylsilylethenyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 70498124 |
| Molecular Formula | C18H20ClFN2O2Si |
| Molecular Weight | 378.91 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | methyl 4-amino-6-(4-chlorophenyl)-5-fluoro-3-(2-trimethylsilylethenyl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccc(Cl)cc2)c(F)c(N)c1C=C[Si](C)(C)C |
| InChI | InChI=1S/C18H20ClFN2O2Si/c1-24-18(23)17-13(9-10-25(2,3)4)15(21)14(20)16(22-17)11-5-7-12(19)8-6-11/h5-10H,1-4H3,(H2,21,22) |
| InChIKey | SPECCEUIWQOYLF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.91 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|