C16H18ClFN2O2Si — CID 172742481
methyl 4-amino-6-chloro-5-fluoro-3-(4-trimethylsilylphenyl)pyridine-2-carboxylate (PubChem CID 172742481) has the molecular formula C16H18ClFN2O2Si and a molecular weight of 352.87 g/mol. Its IUPAC name is methyl 4-amino-6-chloro-5-fluoro-3-(4-trimethylsilylphenyl)pyridine-2-carboxylate.
| Compound Name | methyl 4-amino-6-chloro-5-fluoro-3-(4-trimethylsilylphenyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 172742481 |
| Molecular Formula | C16H18ClFN2O2Si |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | methyl 4-amino-6-chloro-5-fluoro-3-(4-trimethylsilylphenyl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(Cl)c(F)c(N)c1-c1ccc([Si](C)(C)C)cc1 |
| InChI | InChI=1S/C16H18ClFN2O2Si/c1-22-16(21)14-11(13(19)12(18)15(17)20-14)9-5-7-10(8-6-9)23(2,3)4/h5-8H,1-4H3,(H2,19,20) |
| InChIKey | JHBBEXPBHCBCNS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|