C14H12ClFN2O2 — CID 59432126
methyl 4-amino-6-(4-chlorophenyl)-5-fluoro-3-methylpyridine-2-carboxylate (PubChem CID 59432126) has the molecular formula C14H12ClFN2O2 and a molecular weight of 294.71 g/mol. Its IUPAC name is methyl 4-amino-6-(4-chlorophenyl)-5-fluoro-3-methylpyridine-2-carboxylate.
| Compound Name | methyl 4-amino-6-(4-chlorophenyl)-5-fluoro-3-methylpyridine-2-carboxylate |
|---|---|
| PubChem CID | 59432126 |
| Molecular Formula | C14H12ClFN2O2 |
| Molecular Weight | 294.71 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | methyl 4-amino-6-(4-chlorophenyl)-5-fluoro-3-methylpyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccc(Cl)cc2)c(F)c(N)c1C |
| InChI | InChI=1S/C14H12ClFN2O2/c1-7-11(17)10(16)13(18-12(7)14(19)20-2)8-3-5-9(15)6-4-8/h3-6H,1-2H3,(H2,17,18) |
| InChIKey | IUMQWIIDECJGRL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.71 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |