C14H12FIN2O2 — CID 144501776
methyl 4-amino-5-fluoro-3-iodo-6-(4-methylphenyl)pyridine-2-carboxylate (PubChem CID 144501776) has the molecular formula C14H12FIN2O2 and a molecular weight of 386.16 g/mol. Its IUPAC name is methyl 4-amino-5-fluoro-3-iodo-6-(4-methylphenyl)pyridine-2-carboxylate.
| Compound Name | methyl 4-amino-5-fluoro-3-iodo-6-(4-methylphenyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 144501776 |
| Molecular Formula | C14H12FIN2O2 |
| Molecular Weight | 386.16 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | methyl 4-amino-5-fluoro-3-iodo-6-(4-methylphenyl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccc(C)cc2)c(F)c(N)c1I |
| InChI | InChI=1S/C14H12FIN2O2/c1-7-3-5-8(6-4-7)12-9(15)11(17)10(16)13(18-12)14(19)20-2/h3-6H,1-2H3,(H2,17,18) |
| InChIKey | IVKGXZYRHLBVBS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.16 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|