C14H13FN2O5S — CID 175136305
2-amino-5-fluoro-3-methoxycarbonyl-6-(4-methylphenyl)pyridine-4-sulfonic acid (PubChem CID 175136305) has the molecular formula C14H13FN2O5S and a molecular weight of 340.33 g/mol. Its IUPAC name is 2-amino-5-fluoro-3-methoxycarbonyl-6-(4-methylphenyl)pyridine-4-sulfonic acid.
| Compound Name | 2-amino-5-fluoro-3-methoxycarbonyl-6-(4-methylphenyl)pyridine-4-sulfonic acid |
|---|---|
| PubChem CID | 175136305 |
| Molecular Formula | C14H13FN2O5S |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 2-amino-5-fluoro-3-methoxycarbonyl-6-(4-methylphenyl)pyridine-4-sulfonic acid |
| SMILES | COC(=O)c1c(N)nc(-c2ccc(C)cc2)c(F)c1S(=O)(=O)O |
| InChI | InChI=1S/C14H13FN2O5S/c1-7-3-5-8(6-4-7)11-10(15)12(23(19,20)21)9(13(16)17-11)14(18)22-2/h3-6H,1-2H3,(H2,16,17)(H,19,20,21) |
| InChIKey | OZVKZBNDTKDRAG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 119.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|