C14H14FN3O2 — CID 116647671
methyl 4-amino-2-(3-fluoro-5-methylphenyl)-6-methylpyrimidine-5-carboxylate (PubChem CID 116647671) has the molecular formula C14H14FN3O2 and a molecular weight of 275.28 g/mol. Its IUPAC name is methyl 4-amino-2-(3-fluoro-5-methylphenyl)-6-methylpyrimidine-5-carboxylate.
| Compound Name | methyl 4-amino-2-(3-fluoro-5-methylphenyl)-6-methylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 116647671 |
| Molecular Formula | C14H14FN3O2 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | methyl 4-amino-2-(3-fluoro-5-methylphenyl)-6-methylpyrimidine-5-carboxylate |
| SMILES | COC(=O)c1c(C)nc(-c2cc(C)cc(F)c2)nc1N |
| InChI | InChI=1S/C14H14FN3O2/c1-7-4-9(6-10(15)5-7)13-17-8(2)11(12(16)18-13)14(19)20-3/h4-6H,1-3H3,(H2,16,17,18) |
| InChIKey | HGJPCHLKIIQRKD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |